EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:41531 - methyl L-cysteinate
| Formula | C4H9NO2S |
| Net Charge | 0 |
| Average Mass | 135.188 |
| Monoisotopic Mass | 135.03540 |
| SMILES | COC(=O)[C@@H](N)CS |
| InChI | InChI=1S/C4H9NO2S/c1-7-4(6)3(5)2-8/h3,8H,2,5H2,1H3/t3-/m0/s1 |
| InChIKey | MCYHPZGUONZRGO-VKHMYHEASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | mucolytic A compound that alters the structure of mucus so as to decrease its viscosity and thereby facilitate its removal by ciliary action and expectoration. Compare with antitussives, which suppress the cough reflex, and expectorants, which are considered to increase the volume of secretions in the respiratory tract, so facilitating their removal by ciliary action and coughing. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl L-cysteinate (CHEBI:41531) has functional parent L-cysteine (CHEBI:17561) |
| methyl L-cysteinate (CHEBI:41531) has functional parent methanol (CHEBI:17790) |
| methyl L-cysteinate (CHEBI:41531) has role mucolytic (CHEBI:77034) |
| methyl L-cysteinate (CHEBI:41531) is a L-cysteinyl ester (CHEBI:61894) |
| methyl L-cysteinate (CHEBI:41531) is a primary amino compound (CHEBI:50994) |
| methyl L-cysteinate (CHEBI:41531) is a thiol (CHEBI:29256) |
| Incoming Relation(s) |
| methyl L-cysteinato group (CHEBI:61989) is substituent group from methyl L-cysteinate (CHEBI:41531) |
| IUPAC Name |
|---|
| methyl L-cysteinate |
| INNs | Source |
|---|---|
| mecysteinum | ChemIDplus |
| mecisteína | WHO MedNet |
| mecysteine | ChemIDplus |
| mécystéine | WHO MedNet |
| Synonyms | Source |
|---|---|
| O-METHYLCYSTEINE | PDBeChem |
| cysteine methyl ester | ChemIDplus |
| methyl (R)-cysteinate | ChemIDplus |
| Citations |
|---|