EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14F3N3O2S |
| Net Charge | 0 |
| Average Mass | 381.379 |
| Monoisotopic Mass | 381.07588 |
| SMILES | Cc1ccc(-c2cc(C(F)(F)F)nn2-c2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C17H14F3N3O2S/c1-11-2-4-12(5-3-11)15-10-16(17(18,19)20)22-23(15)13-6-8-14(9-7-13)26(21,24)25/h2-10H,1H3,(H2,21,24,25) |
| InChIKey | RZEKVGVHFLEQIL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| celecoxib (CHEBI:41423) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| celecoxib (CHEBI:41423) has role geroprotector (CHEBI:176497) |
| celecoxib (CHEBI:41423) has role non-narcotic analgesic (CHEBI:35481) |
| celecoxib (CHEBI:41423) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| celecoxib (CHEBI:41423) is a organofluorine compound (CHEBI:37143) |
| celecoxib (CHEBI:41423) is a pyrazoles (CHEBI:26410) |
| celecoxib (CHEBI:41423) is a sulfonamide (CHEBI:35358) |
| celecoxib (CHEBI:41423) is a toluenes (CHEBI:27024) |
| IUPAC Name |
|---|
| 4-[5-(4-methylphenyl)-3-(trifluoromethyl)-1H-pyrazol-1-yl]benzenesulfonamide |
| INNs | Source |
|---|---|
| celecoxib | WHO MedNet |
| celecoxib | WHO MedNet |
| célécoxib | WHO MedNet |
| celecoxibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| Celecoxib | KEGG COMPOUND |
| p-(5-p-Tolyl-3-(trifluoromethyl)pyrazol-1-yl)benzenesulfonamide | ChemIDplus |
| Brand Name | Source |
|---|---|
| Celebrex | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8280770 | Reaxys |
| CAS:169590-42-5 | NIST Chemistry WebBook |
| CAS:169590-42-5 | ChemIDplus |
| CAS:184007-95-2 | ChemIDplus |
| Citations |
|---|