EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:41423 - celecoxib
| Formula | C17H14F3N3O2S |
| Net Charge | 0 |
| Average Mass | 381.379 |
| Monoisotopic Mass | 381.07588 |
| SMILES | Cc1ccc(-c2cc(C(F)(F)F)nn2-c2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C17H14F3N3O2S/c1-11-2-4-12(5-3-11)15-10-16(17(18,19)20)22-23(15)13-6-8-14(9-7-13)26(21,24)25/h2-10H,1H3,(H2,21,24,25) |
| InChIKey | RZEKVGVHFLEQIL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| celecoxib (CHEBI:41423) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| celecoxib (CHEBI:41423) has role geroprotector (CHEBI:176497) |
| celecoxib (CHEBI:41423) has role non-narcotic analgesic (CHEBI:35481) |
| celecoxib (CHEBI:41423) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| celecoxib (CHEBI:41423) is a organofluorine compound (CHEBI:37143) |
| celecoxib (CHEBI:41423) is a pyrazoles (CHEBI:26410) |
| celecoxib (CHEBI:41423) is a sulfonamide (CHEBI:35358) |
| celecoxib (CHEBI:41423) is a toluenes (CHEBI:27024) |
| IUPAC Name |
|---|
| 4-[5-(4-methylphenyl)-3-(trifluoromethyl)-1H-pyrazol-1-yl]benzenesulfonamide |
| INNs | Source |
|---|---|
| celecoxib | WHO MedNet |
| celecoxib | WHO MedNet |
| célécoxib | WHO MedNet |
| celecoxibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| Celecoxib | KEGG COMPOUND |
| p-(5-p-Tolyl-3-(trifluoromethyl)pyrazol-1-yl)benzenesulfonamide | ChemIDplus |
| Brand Name | Source |
|---|---|
| Celebrex | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8280770 | Reaxys |
| CAS:169590-42-5 | NIST Chemistry WebBook |
| CAS:169590-42-5 | ChemIDplus |
| CAS:184007-95-2 | ChemIDplus |
| Citations |
|---|