EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16O5 |
| Net Charge | 0 |
| Average Mass | 240.255 |
| Monoisotopic Mass | 240.09977 |
| SMILES | CCCc1oc(CCC(=O)O)c(C(=O)O)c1C |
| InChI | InChI=1S/C12H16O5/c1-3-4-8-7(2)11(12(15)16)9(17-8)5-6-10(13)14/h3-6H2,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | WMCQWXZMVIETAO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (8787801) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). uremic toxin A toxin that accumulates in patients with chronic kidney disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(2-carboxyethyl)-4-methyl-5-propylfuran-3-carboxylic acid (CHEBI:41254) has role human metabolite (CHEBI:77746) |
| 2-(2-carboxyethyl)-4-methyl-5-propylfuran-3-carboxylic acid (CHEBI:41254) has role uremic toxin (CHEBI:64584) |
| 2-(2-carboxyethyl)-4-methyl-5-propylfuran-3-carboxylic acid (CHEBI:41254) is a dicarboxylic acid (CHEBI:35692) |
| 2-(2-carboxyethyl)-4-methyl-5-propylfuran-3-carboxylic acid (CHEBI:41254) is a furoic acid (CHEBI:36055) |
| 2-(2-carboxyethyl)-4-methyl-5-propylfuran-3-carboxylic acid (CHEBI:41254) is conjugate acid of 3-carboxy-4-methyl-5-propyl-2-furanpropanoate (CHEBI:82986) |
| 2-(2-carboxyethyl)-4-methyl-5-propylfuran-3-carboxylic acid (CHEBI:41254) is conjugate acid of 3-carboxy-4-methyl-5-propyl-2-furanpropionate(2−) (CHEBI:194524) |
| Incoming Relation(s) |
| 3-carboxy-4-methyl-5-propyl-2-furanpropanoate (CHEBI:82986) is conjugate base of 2-(2-carboxyethyl)-4-methyl-5-propylfuran-3-carboxylic acid (CHEBI:41254) |
| 3-carboxy-4-methyl-5-propyl-2-furanpropionate(2−) (CHEBI:194524) is conjugate base of 2-(2-carboxyethyl)-4-methyl-5-propylfuran-3-carboxylic acid (CHEBI:41254) |
| IUPAC Name |
|---|
| 2-(2-carboxyethyl)-4-methyl-5-propylfuran-3-carboxylic acid |
| Synonyms | Source |
|---|---|
| 3-Carboxy-4-methyl-5-propyl-2-furanpropionic acid | HMDB |
| CMPF | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C1F | PDBeChem |
| HMDB0061112 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8151669 | Reaxys |
| CAS:86879-39-2 | ChemIDplus |
| Citations |
|---|