EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11N5O3 |
| Net Charge | 0 |
| Average Mass | 237.219 |
| Monoisotopic Mass | 237.08619 |
| SMILES | C[C@@H](O)[C@@H](O)c1cnc2nc(N)nc(=O)c2n1 |
| InChI | InChI=1S/C9H11N5O3/c1-3(15)6(16)4-2-11-7-5(12-4)8(17)14-9(10)13-7/h2-3,6,15-16H,1H3,(H3,10,11,13,14,17)/t3-,6-/m1/s1 |
| InChIKey | LHQIJBMDNUYRAM-AWFVSMACSA-N |
| Roles Classification |
|---|
| Biological Roles: | coenzyme A low-molecular-weight, non-protein organic compound participating in enzymatic reactions as dissociable acceptor or donor of chemical groups or electrons. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-erythro-biopterin (CHEBI:41183) is a biopterin (CHEBI:15373) |
| D-erythro-biopterin (CHEBI:41183) is enantiomer of L-erythro-biopterin (CHEBI:63931) |
| Incoming Relation(s) |
| L-erythro-biopterin (CHEBI:63931) is enantiomer of D-erythro-biopterin (CHEBI:41183) |
| IUPAC Name |
|---|
| 2-amino-6-[(1S,2R)-11]pteridin-4(3H)-one |
| Synonyms | Source |
|---|---|
| Biopterin | DrugBank |
| (S,R)-biopterin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| DB03886 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5380765 | Reaxys |