EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11N5O3 |
| Net Charge | 0 |
| Average Mass | 237.219 |
| Monoisotopic Mass | 237.08619 |
| SMILES | C[C@@H](O)[C@@H](O)c1cnc2nc(N)nc(=O)c2n1 |
| InChI | InChI=1S/C9H11N5O3/c1-3(15)6(16)4-2-11-7-5(12-4)8(17)14-9(10)13-7/h2-3,6,15-16H,1H3,(H3,10,11,13,14,17)/t3-,6-/m1/s1 |
| InChIKey | LHQIJBMDNUYRAM-AWFVSMACSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. coenzyme A low-molecular-weight, non-protein organic compound participating in enzymatic reactions as dissociable acceptor or donor of chemical groups or electrons. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-erythro-biopterin (CHEBI:41183) is a biopterin (CHEBI:15373) |
| D-erythro-biopterin (CHEBI:41183) is enantiomer of L-erythro-biopterin (CHEBI:63931) |
| Incoming Relation(s) |
| L-erythro-biopterin (CHEBI:63931) is enantiomer of D-erythro-biopterin (CHEBI:41183) |
| IUPAC Name |
|---|
| 2-amino-6-[(1S,2R)-11]pteridin-4(3H)-one |
| Synonyms | Source |
|---|---|
| Biopterin | DrugBank |
| (S,R)-biopterin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| DB03886 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5380765 | Reaxys |