EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11N5O3 |
| Net Charge | 0 |
| Average Mass | 237.219 |
| Monoisotopic Mass | 237.08619 |
| SMILES | CC(O)C(O)c1cnc2nc(N)nc(=O)c2n1 |
| InChI | InChI=1S/C9H11N5O3/c1-3(15)6(16)4-2-11-7-5(12-4)8(17)14-9(10)13-7/h2-3,6,15-16H,1H3,(H3,10,11,13,14,17) |
| InChIKey | LHQIJBMDNUYRAM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. coenzyme A low-molecular-weight, non-protein organic compound participating in enzymatic reactions as dissociable acceptor or donor of chemical groups or electrons. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| biopterin (CHEBI:15373) has role coenzyme (CHEBI:23354) |
| biopterin (CHEBI:15373) has role metabolite (CHEBI:25212) |
| biopterin (CHEBI:15373) is a biopterins (CHEBI:22881) |
| Incoming Relation(s) |
| D-erythro-biopterin (CHEBI:41183) is a biopterin (CHEBI:15373) |
| L-erythro-biopterin (CHEBI:63931) is a biopterin (CHEBI:15373) |
| IUPAC Name |
|---|
| 2-amino-6-(1,2-dihydroxypropyl)pteridin-4(3H)-one |
| Synonyms | Source |
|---|---|
| 2-amino-6-(1,2-dihydroxypropyl)-4(1H)-pteridinone | ChEBI |
| 2-Amino-6-(1,2-dihydroxypropyl)-4(1H)-pteridinone | KEGG COMPOUND |
| Biopterin | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:234314 | Reaxys |
| CAS:22150-76-1 | ChemIDplus |
| Citations |
|---|