EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O6 |
| Net Charge | 0 |
| Average Mass | 180.156 |
| Monoisotopic Mass | 180.06339 |
| SMILES | OC[C@H]1OC(O)[C@H](O)[C@H](O)[C@@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a2222h-1x_1-5]/1/ |
| InChI | InChI=1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4-,5-,6?/m1/s1 |
| InChIKey | WQZGKKKJIJFFOK-IVMDWMLBSA-N |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-allopyranose (CHEBI:4093) has role antioxidant (CHEBI:22586) |
| D-allopyranose (CHEBI:4093) is a D-allose (CHEBI:17393) |
| D-allopyranose (CHEBI:4093) is a allopyranose (CHEBI:37742) |
| D-allopyranose (CHEBI:4093) is enantiomer of L-allopyranose (CHEBI:37741) |
| Incoming Relation(s) |
| α-D-allose (CHEBI:37686) is a D-allopyranose (CHEBI:4093) |
| β-D-allose (CHEBI:40656) is a D-allopyranose (CHEBI:4093) |
| L-allopyranose (CHEBI:37741) is enantiomer of D-allopyranose (CHEBI:4093) |
| IUPAC Name |
|---|
| D-allopyranose |
| Synonym | Source |
|---|---|
| D-Allose | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C01487 | KEGG COMPOUND |
| D-allopyranose | MetaCyc |
| DB03989 | DrugBank |
| G74407MX | GlyTouCan |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1907363 | Reaxys |
| Gmelin:972272 | Gmelin |
| CAS:2595-97-3 | KEGG COMPOUND |
| Citations |
|---|