EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O6 |
| Net Charge | 0 |
| Average Mass | 180.156 |
| Monoisotopic Mass | 180.06339 |
| SMILES | OC[C@H]1O[C@H](O)[C@H](O)[C@H](O)[C@@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a2222h-1a_1-5]/1/ |
| InChI | InChI=1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4-,5-,6+/m1/s1 |
| InChIKey | WQZGKKKJIJFFOK-UKFBFLRUSA-N |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-D-allose (CHEBI:37686) is a D-allopyranose (CHEBI:4093) |
| α-D-allose (CHEBI:37686) is enantiomer of α-L-allose (CHEBI:37744) |
| Incoming Relation(s) |
| α-L-allose (CHEBI:37744) is enantiomer of α-D-allose (CHEBI:37686) |
| IUPAC Name |
|---|
| α-D-allopyranose |
| Manual Xrefs | Databases |
|---|---|
| G10899AB | GlyTouCan |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1281611 | Beilstein |