EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17N3O4 |
| Net Charge | 0 |
| Average Mass | 315.329 |
| Monoisotopic Mass | 315.12191 |
| SMILES | [H][C@@]12CC(/C=C/C(N)=O)=CN1C(=O)c1ccc(C)c(O)c1N[C@@H]2O |
| InChI | InChI=1S/C16H17N3O4/c1-8-2-4-10-13(14(8)21)18-15(22)11-6-9(3-5-12(17)20)7-19(11)16(10)23/h2-5,7,11,15,18,21-22H,6H2,1H3,(H2,17,20)/b5-3+/t11-,15+/m0/s1 |
| InChIKey | VGQOVCHZGQWAOI-YQRHFANHSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces refuineus subsp. thermotolerans (ncbitaxon:223297) | - | PubMed (17584616) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. toxin Poisonous substance produced by a biological organism such as a microbe, animal or plant. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. alkylating agent Highly reactive chemical that introduces alkyl radicals into biologically active molecules and thereby prevents their proper functioning. It could be used as an antineoplastic agent, but it might be very toxic, with carcinogenic, mutagenic, teratogenic, and immunosuppressant actions. It could also be used as a component of poison gases. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| anthramycin (CHEBI:40699) has role alkylating agent (CHEBI:22333) |
| anthramycin (CHEBI:40699) has role antibacterial agent (CHEBI:33282) |
| anthramycin (CHEBI:40699) has role antineoplastic agent (CHEBI:35610) |
| anthramycin (CHEBI:40699) has role bacterial metabolite (CHEBI:76969) |
| anthramycin (CHEBI:40699) has role toxin (CHEBI:27026) |
| anthramycin (CHEBI:40699) is a enamide (CHEBI:51751) |
| anthramycin (CHEBI:40699) is a phenols (CHEBI:33853) |
| anthramycin (CHEBI:40699) is a primary amide (CHEBI:33256) |
| anthramycin (CHEBI:40699) is a pyrrolobenzodiazepine (CHEBI:131437) |
| IUPAC Name |
|---|
| (2E)-3-[(11R,11aS)-9,11-dihydroxy-8-methyl-5-oxo-5,10,11,11a-tetrahydro-1H-pyrrolo[2,1-c][1,4]benzodiazepin-2-yl]prop-2-enamide |
| INNs | Source |
|---|---|
| antramycinum | WHO MedNet |
| antramycin | WHO MedNet |
| antramicina | WHO MedNet |
| antramycine | WHO MedNet |
| Synonyms | Source |
|---|---|
| anthramycin | ChemIDplus |
| Ro 5-9000 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| ANT | PDBeChem |
| CPD-18441 | MetaCyc |
| D02952 | KEGG DRUG |
| Anthramycin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:4803-27-4 | ChemIDplus |
| Citations |
|---|