EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9NO3 |
| Net Charge | 0 |
| Average Mass | 119.120 |
| Monoisotopic Mass | 119.05824 |
| SMILES | C[C@H](O)[C@H](N)C(=O)O |
| InChI | InChI=1S/C4H9NO3/c1-2(6)3(5)4(7)8/h2-3,6H,5H2,1H3,(H,7,8)/t2-,3-/m0/s1 |
| InChIKey | AYFVYJQAPQTCCC-HRFVKAFMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-allothreonine (CHEBI:28718) has role Escherichia coli metabolite (CHEBI:76971) |
| L-allothreonine (CHEBI:28718) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| L-allothreonine (CHEBI:28718) is a L-α-amino acid (CHEBI:15705) |
| L-allothreonine (CHEBI:28718) is a allothreonine (CHEBI:38262) |
| L-allothreonine (CHEBI:28718) is enantiomer of D-allothreonine (CHEBI:32826) |
| L-allothreonine (CHEBI:28718) is tautomer of L-allothreonine zwitterion (CHEBI:58585) |
| Incoming Relation(s) |
| D-allothreonine (CHEBI:32826) is enantiomer of L-allothreonine (CHEBI:28718) |
| L-allothreonine zwitterion (CHEBI:58585) is tautomer of L-allothreonine (CHEBI:28718) |
| IUPAC Name |
|---|
| L-allothreonine |
| Synonyms | Source |
|---|---|
| (2S,3S)-2-amino-3-hydroxybutanoic acid | IUPAC |
| allo-L-threonine | ChemIDplus |
| ALLO-THREONINE | PDBeChem |
| L-allo-Threonine | KEGG COMPOUND |
| L-Allothreonine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| ALO | PDBeChem |
| C05519 | KEGG COMPOUND |
| C05519 | KEGG COMPOUND |
| HMDB0004041 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1721645 | Reaxys |
| CAS:28954-12-3 | ChemIDplus |
| CAS:28954-12-3 | KEGG COMPOUND |
| Citations |
|---|