EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9NO3 |
| Net Charge | 0 |
| Average Mass | 119.120 |
| Monoisotopic Mass | 119.05824 |
| SMILES | C[C@H](O)[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C4H9NO3/c1-2(6)3(5)4(7)8/h2-3,6H,5H2,1H3,(H,7,8)/t2-,3-/m0/s1 |
| InChIKey | AYFVYJQAPQTCCC-HRFVKAFMSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-allothreonine zwitterion (CHEBI:58585) is a L-α-amino acid zwitterion (CHEBI:59869) |
| L-allothreonine zwitterion (CHEBI:58585) is tautomer of L-allothreonine (CHEBI:28718) |
| Incoming Relation(s) |
| L-allothreonine (CHEBI:28718) is tautomer of L-allothreonine zwitterion (CHEBI:58585) |
| IUPAC Name |
|---|
| (2S,3S)-2-ammonio-3-hydroxybutanoate |
| UniProt Name | Source |
|---|---|
| L-allo-threonine | UniProt |