EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:32826 - D-allothreonine
| Formula | C4H9NO3 |
| Net Charge | 0 |
| Average Mass | 119.120 |
| Monoisotopic Mass | 119.05824 |
| SMILES | C[C@@H](O)[C@@H](N)C(=O)O |
| InChI | InChI=1S/C4H9NO3/c1-2(6)3(5)4(7)8/h2-3,6H,5H2,1H3,(H,7,8)/t2-,3-/m1/s1 |
| InChIKey | AYFVYJQAPQTCCC-PWNYCUMCSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-allothreonine (CHEBI:32826) has role bacterial metabolite (CHEBI:76969) |
| D-allothreonine (CHEBI:32826) is a D-α-amino acid (CHEBI:16733) |
| D-allothreonine (CHEBI:32826) is a allothreonine (CHEBI:38262) |
| D-allothreonine (CHEBI:32826) is enantiomer of L-allothreonine (CHEBI:28718) |
| D-allothreonine (CHEBI:32826) is tautomer of D-allothreonine zwitterion (CHEBI:58645) |
| Incoming Relation(s) |
| L-allothreonine (CHEBI:28718) is enantiomer of D-allothreonine (CHEBI:32826) |
| D-allothreonine zwitterion (CHEBI:58645) is tautomer of D-allothreonine (CHEBI:32826) |
| IUPAC Name |
|---|
| D-allothreonine |
| Synonyms | Source |
|---|---|
| (2R,3R)-2-amino-3-hydroxybutanoic acid | IUPAC |
| D-Allothreonine | KEGG COMPOUND |
| D-allo-Threonine | KEGG COMPOUND |
| (2R,3R)-allothreonine | ChemIDplus |
| (R)-allothreonine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1721644 | Reaxys |
| CAS:24830-94-2 | ChemIDplus |
| CAS:24830-94-2 | KEGG COMPOUND |
| Citations |
|---|