EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H7NO3 |
| Net Charge | 0 |
| Average Mass | 117.104 |
| Monoisotopic Mass | 117.04259 |
| SMILES | CC(=O)[C@H](N)C(=O)O |
| InChI | InChI=1S/C4H7NO3/c1-2(6)3(5)4(7)8/h3H,5H2,1H3,(H,7,8)/t3-/m0/s1 |
| InChIKey | SAUCHDKDCUROAO-VKHMYHEASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-2-amino-3-oxobutanoic acid (CHEBI:40673) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| L-2-amino-3-oxobutanoic acid (CHEBI:40673) has role human metabolite (CHEBI:77746) |
| L-2-amino-3-oxobutanoic acid (CHEBI:40673) is a 2-amino-3-oxobutanoic acid (CHEBI:17844) |
| L-2-amino-3-oxobutanoic acid (CHEBI:40673) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| L-2-amino-3-oxobutanoic acid (CHEBI:40673) is conjugate acid of L-2-amino-3-oxobutanoate (CHEBI:16944) |
| L-2-amino-3-oxobutanoic acid (CHEBI:40673) is tautomer of L-2-amino-3-oxobutanoic acid zwitterion (CHEBI:78948) |
| Incoming Relation(s) |
| L-2-amino-3-oxobutanoate (CHEBI:16944) is conjugate base of L-2-amino-3-oxobutanoic acid (CHEBI:40673) |
| L-2-amino-3-oxobutanoic acid zwitterion (CHEBI:78948) is tautomer of L-2-amino-3-oxobutanoic acid (CHEBI:40673) |
| IUPAC Name |
|---|
| (2S)-2-amino-3-oxobutanoic acid |
| Synonyms | Source |
|---|---|
| 2-AMINO-3-KETOBUTYRIC ACID | PDBeChem |
| L-2-Amino-3-oxobutanoate | KEGG COMPOUND |
| L-2-Amino-3-oxobutanoic acid | KEGG COMPOUND |
| L-2-Amino-acetoacetate | KEGG COMPOUND |
| (S)-2-Amino-3-oxobutanoic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| AKB | PDBeChem |
| C03508 | KEGG COMPOUND |
| DB03915 | DrugBank |
| LMFA01060172 | LIPID MAPS |