EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H7NO3 |
| Net Charge | 0 |
| Average Mass | 117.104 |
| Monoisotopic Mass | 117.04259 |
| SMILES | CC(=O)C(N)C(=O)O |
| InChI | InChI=1S/C4H7NO3/c1-2(6)3(5)4(7)8/h3H,5H2,1H3,(H,7,8) |
| InChIKey | SAUCHDKDCUROAO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-3-oxobutanoic acid (CHEBI:17844) has functional parent butyric acid (CHEBI:30772) |
| 2-amino-3-oxobutanoic acid (CHEBI:17844) is a 3-oxo monocarboxylic acid (CHEBI:47881) |
| 2-amino-3-oxobutanoic acid (CHEBI:17844) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| Incoming Relation(s) |
| L-2-amino-3-oxobutanoic acid (CHEBI:40673) is a 2-amino-3-oxobutanoic acid (CHEBI:17844) |
| IUPAC Name |
|---|
| 2-amino-3-oxobutanoic acid |
| Synonyms | Source |
|---|---|
| 2-amino-3-ketobutyrate | ChemIDplus |
| 2-Amino-3-oxobutanoate | KEGG COMPOUND |
| 2-Amino-acetoacetate | KEGG COMPOUND |