EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:30915 - 2-oxoglutaric acid
| Formula | C5H6O5 |
| Net Charge | 0 |
| Average Mass | 146.098 |
| Monoisotopic Mass | 146.02152 |
| SMILES | O=C(O)CCC(=O)C(=O)O |
| InChI | InChI=1S/C5H6O5/c6-3(5(9)10)1-2-4(7)8/h1-2H2,(H,7,8)(H,9,10) |
| InChIKey | KPGXRSRHYNQIFN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-oxoglutaric acid (CHEBI:30915) has functional parent glutaric acid (CHEBI:17859) |
| 2-oxoglutaric acid (CHEBI:30915) has role fundamental metabolite (CHEBI:78675) |
| 2-oxoglutaric acid (CHEBI:30915) is a oxo dicarboxylic acid (CHEBI:36145) |
| 2-oxoglutaric acid (CHEBI:30915) is conjugate acid of 2-oxoglutarate(1−) (CHEBI:30916) |
| Incoming Relation(s) |
| 2-oxoglutaryl-CoA (CHEBI:71364) has functional parent 2-oxoglutaric acid (CHEBI:30915) |
| oxalosuccinic acid (CHEBI:7815) has functional parent 2-oxoglutaric acid (CHEBI:30915) |
| 2-oxoglutarate(1−) (CHEBI:30916) is conjugate base of 2-oxoglutaric acid (CHEBI:30915) |
| IUPAC Name |
|---|
| 2-oxopentanedioic acid |
| Synonyms | Source |
|---|---|
| 2-Ketoglutaric acid | KEGG COMPOUND |
| alpha-Ketoglutaric acid | KEGG COMPOUND |
| Oxoglutaric acid | KEGG COMPOUND |
| α-ketoglutaric acid | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| 2-KETOGLUTARATE | MetaCyc |
| AKG | PDBeChem |
| Alpha-Ketoglutaric_acid | Wikipedia |
| C00000769 | KNApSAcK |
| C00026 | KEGG COMPOUND |
| DB02926 | DrugBank |
| HMDB0000208 | HMDB |
| Citations |
|---|