EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H5O5 |
| Net Charge | -1 |
| Average Mass | 145.090 |
| Monoisotopic Mass | 145.01425 |
| SMILES | O=C(O)CCC(=O)C(=O)[O-] |
| InChI | InChI=1S/C5H6O5/c6-3(5(9)10)1-2-4(7)8/h1-2H2,(H,7,8)(H,9,10)/p-1 |
| InChIKey | KPGXRSRHYNQIFN-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-oxoglutarate(1−) (CHEBI:30916) has functional parent glutarate(1−) (CHEBI:35907) |
| 2-oxoglutarate(1−) (CHEBI:30916) has role fundamental metabolite (CHEBI:78675) |
| 2-oxoglutarate(1−) (CHEBI:30916) is a dicarboxylic acid monoanion (CHEBI:35695) |
| 2-oxoglutarate(1−) (CHEBI:30916) is conjugate acid of 2-oxoglutarate(2−) (CHEBI:16810) |
| 2-oxoglutarate(1−) (CHEBI:30916) is conjugate base of 2-oxoglutaric acid (CHEBI:30915) |
| Incoming Relation(s) |
| 2-oxoglutaric acid (CHEBI:30915) is conjugate acid of 2-oxoglutarate(1−) (CHEBI:30916) |
| 2-oxoglutarate(2−) (CHEBI:16810) is conjugate base of 2-oxoglutarate(1−) (CHEBI:30916) |
| IUPAC Name |
|---|
| 4-carboxy-2-oxobutanoate |
| Synonym | Source |
|---|---|
| 2-ketoglutarate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Gmelin:2159365 | Gmelin |
| Reaxys:4132418 | Reaxys |