EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16N2O4S |
| Net Charge | 0 |
| Average Mass | 308.359 |
| Monoisotopic Mass | 308.08308 |
| SMILES | CC(=O)NCCNc1cccc2c(S(=O)(=O)O)cccc12 |
| InChI | InChI=1S/C14H16N2O4S/c1-10(17)15-8-9-16-13-6-2-5-12-11(13)4-3-7-14(12)21(18,19)20/h2-7,16H,8-9H2,1H3,(H,15,17)(H,18,19,20) |
| InChIKey | FBZFLXJHAMMUQM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | fluorescent probe A role played by a fluorescent molecular entity used to study the microscopic environment by fluorescence spectroscopy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-[(2-acetamidoethyl)amino]naphthalene-1-sulfonic acid (CHEBI:40594) has role fluorescent probe (CHEBI:39442) |
| 5-[(2-acetamidoethyl)amino]naphthalene-1-sulfonic acid (CHEBI:40594) is a aminonaphthalenesulfonic acid (CHEBI:38210) |
| IUPAC Name |
|---|
| 5-[(2-acetamidoethyl)amino]naphthalene-1-sulfonic acid |
| Synonyms | Source |
|---|---|
| 1,5-Aedans | ChemIDplus |
| 5-(1-SULFONAPHTHYL)-ACETYLAMINO-ETHYLAMINE | PDBeChem |
| 5-((2-(acetylamino)ethyl)amino)-1-naphthalenesulfonic acid | ChemIDplus |
| AED | ChEBI |
| N-acetyl-N'-(5-sulfonic-1-naphthyl) ethylene diamine | ChEBI |
| N-(aminoethyl)-5-naphthylamine-l-sulfonic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| AEN | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2760789 | Reaxys |
| CAS:50402-62-5 | ChemIDplus |
| Citations |
|---|