EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10N2O3S |
| Net Charge | 0 |
| Average Mass | 178.213 |
| Monoisotopic Mass | 178.04121 |
| SMILES | N[C@@H](CS)C(=O)NCC(=O)O |
| InChI | InChI=1S/C5H10N2O3S/c6-3(2-11)5(10)7-1-4(8)9/h3,11H,1-2,6H2,(H,7,10)(H,8,9)/t3-/m0/s1 |
| InChIKey | ZUKPVRWZDMRIEO-VKHMYHEASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-cysteinylglycine (CHEBI:4047) has role Escherichia coli metabolite (CHEBI:76971) |
| L-cysteinylglycine (CHEBI:4047) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| L-cysteinylglycine (CHEBI:4047) has role human metabolite (CHEBI:77746) |
| L-cysteinylglycine (CHEBI:4047) is a dipeptide (CHEBI:46761) |
| L-cysteinylglycine (CHEBI:4047) is tautomer of L-cysteinylglycine zwitterion (CHEBI:61694) |
| Incoming Relation(s) |
| S-[(E)-N-hydroxy-2-(indol-3-yl)ethanimidoyl]-L-cysteinylglycine (CHEBI:137672) has functional parent L-cysteinylglycine (CHEBI:4047) |
| S-[(Z)-N-hydroxy-2-phenylethanimidoyl]-L-cysteinylglycine (CHEBI:137669) has functional parent L-cysteinylglycine (CHEBI:4047) |
| Cys(IAN)-Gly (CHEBI:137676) has functional parent L-cysteinylglycine (CHEBI:4047) |
| L-cysteinylglycine zwitterion (CHEBI:61694) is tautomer of L-cysteinylglycine (CHEBI:4047) |
| IUPAC Name |
|---|
| L-cysteinylglycine |
| Synonyms | Source |
|---|---|
| Cys-Gly | KEGG COMPOUND |
| L-Cysteinylglycine | KEGG COMPOUND |
| Cysteinylglycine | ChemIDplus |
| N-L-cysteinylglycine | ChemIDplus |
| CG | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C01419 | KEGG COMPOUND |
| CYS-GLY | MetaCyc |
| HMDB0000078 | HMDB |
| ECMDB00078 | ECMDB |
| YMDB00690 | YMDB |
| Registry Numbers | Sources |
|---|---|
| Gmelin:83158 | Gmelin |
| Reaxys:1724689 | Reaxys |
| CAS:19246-18-5 | KEGG COMPOUND |
| CAS:19246-18-5 | ChemIDplus |
| Citations |
|---|