EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:4042 - cypermethrin
| Formula | C22H19Cl2NO3 |
| Net Charge | 0 |
| Average Mass | 416.304 |
| Monoisotopic Mass | 415.07420 |
| SMILES | CC1(C)C(C=C(Cl)Cl)C1C(=O)OC(C#N)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C22H19Cl2NO3/c1-22(2)17(12-19(23)24)20(22)21(26)28-18(13-25)14-7-6-10-16(11-14)27-15-8-4-3-5-9-15/h3-12,17-18,20H,1-2H3 |
| InChIKey | KAATUXNTWXVJKI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | |
| Applications: | molluscicide A substance used to destroy pests of the phylum Mollusca. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cypermethrin (CHEBI:4042) has functional parent 3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylic acid (CHEBI:39308) |
| cypermethrin (CHEBI:4042) has role agrochemical (CHEBI:33286) |
| cypermethrin (CHEBI:4042) has role molluscicide (CHEBI:33904) |
| cypermethrin (CHEBI:4042) has role pyrethroid ester acaricide (CHEBI:39259) |
| cypermethrin (CHEBI:4042) has role pyrethroid ester insecticide (CHEBI:39116) |
| cypermethrin (CHEBI:4042) is a aromatic ether (CHEBI:35618) |
| cypermethrin (CHEBI:4042) is a cyclopropanecarboxylate ester (CHEBI:50351) |
| cypermethrin (CHEBI:4042) is a nitrile (CHEBI:18379) |
| cypermethrin (CHEBI:4042) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| cyano(3-phenoxyphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate |
| Synonyms | Source |
|---|---|
| Cypermethrin | KEGG COMPOUND |
| α-Cyano(3-phenoxyphenyl)methyl (±)cis,trans-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate | ChemIDplus |
| Citations |
|---|