EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H27NO3S |
| Net Charge | 0 |
| Average Mass | 325.474 |
| Monoisotopic Mass | 325.17116 |
| SMILES | CCCC(=NOCC)C1=C(O)CC(C2CCCSC2)CC1=O |
| InChI | InChI=1S/C17H27NO3S/c1-3-6-14(18-21-4-2)17-15(19)9-13(10-16(17)20)12-7-5-8-22-11-12/h12-13,19H,3-11H2,1-2H3 |
| InChIKey | GGWHBJGBERXSLL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | fatty acid synthesis inhibitor Any pathway inhibitor that inhibits the synthesis of fatty acids. EC 6.4.1.2 (acetyl-CoA carboxylase) inhibitor An EC 6.4.1.* (C‒C bond-forming ligase) inhibitor that interferes with the action of acetyl-CoA carboxylase (EC 6.4.1.2). |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cycloxydim (CHEBI:4033) has role agrochemical (CHEBI:33286) |
| cycloxydim (CHEBI:4033) has role EC 6.4.1.2 (acetyl-CoA carboxylase) inhibitor (CHEBI:70722) |
| cycloxydim (CHEBI:4033) has role fatty acid synthesis inhibitor (CHEBI:50185) |
| cycloxydim (CHEBI:4033) has role herbicide (CHEBI:24527) |
| cycloxydim (CHEBI:4033) is a enol (CHEBI:33823) |
| cycloxydim (CHEBI:4033) is a organosulfur heterocyclic compound (CHEBI:38106) |
| cycloxydim (CHEBI:4033) is a oxime O-ether (CHEBI:36816) |
| cycloxydim (CHEBI:4033) is a β-diketone (CHEBI:67265) |
| IUPAC Name |
|---|
| 2-(N-ethoxybutanimidoyl)-3-hydroxy-5-(tetrahydro-2H-thiopyran-3-yl)cyclohex-2-en-1-one |
| Synonyms | Source |
|---|---|
| cycloxydime | ChEBI |
| 2-[1-(ethoxyimino)butyl]-3-hydroxy-5-(tetrahydro-2H-thiopyran-3-yl)-2-cyclohexen-1-one | Alan Wood's Pesticides |
| (5Ξ)-2-[(1Ξ)-N-ethoxybutanimidoyl]-3-hydroxy-5-[(3Ξ)-thian-3-yl]cyclohex-2-en-1-one | Alan Wood's Pesticides |
| BAS 517-02H | ChemIDplus |
| BAS 517 | ChemIDplus |
| BAS 517H | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C10913 | KEGG COMPOUND |
| cycloxydim | Alan Wood's Pesticides |
| 189 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8860903 | Reaxys |
| CAS:101205-02-1 | KEGG COMPOUND |
| CAS:101205-02-1 | Alan Wood's Pesticides |
| Citations |
|---|