EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H15F6N5O |
| Net Charge | 0 |
| Average Mass | 407.318 |
| Monoisotopic Mass | 407.11808 |
| SMILES | N[C@@H](CC(=O)N1CCn2c(nnc2C(F)(F)F)C1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C16H15F6N5O/c17-10-6-12(19)11(18)4-8(10)3-9(23)5-14(28)26-1-2-27-13(7-26)24-25-15(27)16(20,21)22/h4,6,9H,1-3,5,7,23H2/t9-/m1/s1 |
| InChIKey | MFFMDFFZMYYVKS-SECBINFHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | EC 3.4.14.5 (dipeptidyl-peptidase IV) inhibitor An EC 3.4.14.* (dipeptidyl- and tripeptidyl-peptidases) inhibitor that specifically inhibits dipeptidyl peptidase-4 (EC 3.4.14.5). serine proteinase inhibitor An exogenous or endogenous compound which inhibits serine endopeptidases. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sitagliptin (CHEBI:40237) has role EC 3.4.14.5 (dipeptidyl-peptidase IV) inhibitor (CHEBI:68612) |
| sitagliptin (CHEBI:40237) has role environmental contaminant (CHEBI:78298) |
| sitagliptin (CHEBI:40237) has role hypoglycemic agent (CHEBI:35526) |
| sitagliptin (CHEBI:40237) has role serine proteinase inhibitor (CHEBI:48353) |
| sitagliptin (CHEBI:40237) has role xenobiotic (CHEBI:35703) |
| sitagliptin (CHEBI:40237) is a triazolopyrazine (CHEBI:48277) |
| sitagliptin (CHEBI:40237) is a trifluorobenzene (CHEBI:83576) |
| Incoming Relation(s) |
| (1S,2R,5S)-5-[3-(trifluoromethyl)-5,6-dihydro[1,2,4]triazolo[4,3-a]pyrazin-7(8H)-yl]-2-(2,4,5-trifluorophenyl)cyclohexanamine (CHEBI:39959) has functional parent sitagliptin (CHEBI:40237) |
| IUPAC Name |
|---|
| (3R)-3-amino-1-[3-(trifluoromethyl)-5,6-dihydro[1,2,4]triazolo[4,3-a]pyrazin-7(8H)-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
| INNs | Source |
|---|---|
| sitagliptin | WHO MedNet |
| sitagliptine | WHO MedNet |
| sitagliptina | WHO MedNet |
| sitagliptinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (2R)-4-OXO-4-[3-(TRIFLUOROMETHYL)-5,6-DIHYDRO[1,2,4]TRIAZOLO[4,3-A]PYRAZIN-7(8H)-YL]-1-(2,4,5-TRIFLUOROPHENYL)BUTAN-2-AMINE | PDBeChem |
| MK-0431 | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 715 | PDBeChem |
| DB01261 | DrugBank |
| Sitagliptin | Wikipedia |
| D08516 | KEGG DRUG |
| HMDB0015390 | HMDB |
| LSM-5363 | LINCS |
| 2448 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9962060 | Reaxys |
| CAS:486460-32-6 | ChemIDplus |
| Citations |
|---|