EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19F6N5 |
| Net Charge | 0 |
| Average Mass | 419.373 |
| Monoisotopic Mass | 419.15446 |
| SMILES | [H][C@]1(N2CCn3c(nnc3C(F)(F)F)C2)CC[C@]([H])(c2cc(F)c(F)cc2F)[C@@H](N)C1 |
| InChI | InChI=1S/C18H19F6N5/c19-12-7-14(21)13(20)6-11(12)10-2-1-9(5-15(10)25)28-3-4-29-16(8-28)26-27-17(29)18(22,23)24/h6-7,9-10,15H,1-5,8,25H2/t9-,10+,15-/m0/s1 |
| InChIKey | CNKRZILQBKJWDS-WMFXKJRFSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.4.* (hydrolases acting on peptide bond) inhibitor A hydrolase inhibitor that interferes with the action of any hydrolase acting on peptide bonds (peptidase), EC 3.4.*.*). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S,2R,5S)-5-[3-(trifluoromethyl)-5,6-dihydro[1,2,4]triazolo[4,3-a]pyrazin-7(8H)-yl]-2-(2,4,5-trifluorophenyl)cyclohexanamine (CHEBI:39959) has functional parent sitagliptin (CHEBI:40237) |
| (1S,2R,5S)-5-[3-(trifluoromethyl)-5,6-dihydro[1,2,4]triazolo[4,3-a]pyrazin-7(8H)-yl]-2-(2,4,5-trifluorophenyl)cyclohexanamine (CHEBI:39959) has role EC 3.4.* (hydrolases acting on peptide bond) inhibitor (CHEBI:60258) |
| (1S,2R,5S)-5-[3-(trifluoromethyl)-5,6-dihydro[1,2,4]triazolo[4,3-a]pyrazin-7(8H)-yl]-2-(2,4,5-trifluorophenyl)cyclohexanamine (CHEBI:39959) is a organofluorine compound (CHEBI:37143) |
| (1S,2R,5S)-5-[3-(trifluoromethyl)-5,6-dihydro[1,2,4]triazolo[4,3-a]pyrazin-7(8H)-yl]-2-(2,4,5-trifluorophenyl)cyclohexanamine (CHEBI:39959) is a triazolopyrazine (CHEBI:48277) |
| IUPAC Name |
|---|
| (1S,2R,5S)-5-[3-(trifluoromethyl)-5,6-dihydro[1,2,4]triazolo[4,3-a]pyrazin-7(8H)-yl]-2-(2,4,5-trifluorophenyl)cyclohexanamine |
| Synonym | Source |
|---|---|
| (1S,2R,5S)-5-[3-(TRIFLUOROMETHYL)-5,6-DIHYDRO[1,2,4]TRIAZOLO[4,3-A]PYRAZIN-7(8H)-YL]-2-(2,4,5-TRIFLUOROPHENYL)CYCLOHEXANAMINE | PDBeChem |
| Manual Xrefs | Databases |
|---|---|
| 417 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11103093 | Reaxys |
| Citations |
|---|