EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H7NO3 |
| Net Charge | 0 |
| Average Mass | 153.137 |
| Monoisotopic Mass | 153.04259 |
| SMILES | Nc1c(O)cccc1C(=O)O |
| InChI | InChI=1S/C7H7NO3/c8-6-4(7(10)11)2-1-3-5(6)9/h1-3,9H,8H2,(H,10,11) |
| InChIKey | WJXSWCUQABXPFS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (11392499) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (22711758) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxyanthranilic acid (CHEBI:15793) has functional parent anthranilic acid (CHEBI:30754) |
| 3-hydroxyanthranilic acid (CHEBI:15793) has role human metabolite (CHEBI:77746) |
| 3-hydroxyanthranilic acid (CHEBI:15793) has role mouse metabolite (CHEBI:75771) |
| 3-hydroxyanthranilic acid (CHEBI:15793) is a aminobenzoic acid (CHEBI:22495) |
| 3-hydroxyanthranilic acid (CHEBI:15793) is a monohydroxybenzoic acid (CHEBI:25389) |
| 3-hydroxyanthranilic acid (CHEBI:15793) is conjugate acid of 3-hydroxyanthranilate (CHEBI:36559) |
| 3-hydroxyanthranilic acid (CHEBI:15793) is tautomer of 2,3-dihydro-3-oxoanthranilic acid (CHEBI:61149) |
| Incoming Relation(s) |
| 3-hydroxyanthranilate (CHEBI:36559) is conjugate base of 3-hydroxyanthranilic acid (CHEBI:15793) |
| 2,3-dihydro-3-oxoanthranilic acid (CHEBI:61149) is tautomer of 3-hydroxyanthranilic acid (CHEBI:15793) |
| IUPAC Name |
|---|
| 2-amino-3-hydroxybenzoic acid |
| Synonyms | Source |
|---|---|
| 2-Amino-3-hydroxy-benzoic acid | ChemIDplus |
| 2-Amino-3-hydroxybenzoic acid | ChemIDplus |
| 3-Hydroxyanthranilic acid | KEGG COMPOUND |
| 3-Ohaa | ChemIDplus |
| 3-Oxyanthranilic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 3HA | PDBeChem |
| 3-HYDROXY-ANTHRANILATE | MetaCyc |
| 3-hydroxyanthranilic_acid | Wikipedia |
| C00007568 | KNApSAcK |
| C00632 | KEGG COMPOUND |
| DB03644 | DrugBank |
| HMDB0001476 | HMDB |
| LSM-20979 | LINCS |
| Citations |
|---|