EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H8F2O3 |
| Net Charge | 0 |
| Average Mass | 250.200 |
| Monoisotopic Mass | 250.04415 |
| SMILES | O=C(O)c1cc(-c2ccc(F)cc2F)ccc1O |
| InChI | InChI=1S/C13H8F2O3/c14-8-2-3-9(11(15)6-8)7-1-4-12(16)10(5-7)13(17)18/h1-6,16H,(H,17,18) |
| InChIKey | HUPFGZXOMWLGNK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diflunisal (CHEBI:39669) has functional parent 1,3-difluorobenzene (CHEBI:38584) |
| diflunisal (CHEBI:39669) has functional parent salicylic acid (CHEBI:16914) |
| diflunisal (CHEBI:39669) has role non-narcotic analgesic (CHEBI:35481) |
| diflunisal (CHEBI:39669) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| diflunisal (CHEBI:39669) is a monohydroxybenzoic acid (CHEBI:25389) |
| diflunisal (CHEBI:39669) is a organofluorine compound (CHEBI:37143) |
| IUPAC Name |
|---|
| 2',4'-difluoro-4-hydroxy-[1,1'-biphenyl]-3-carboxylic acid |
| Synonyms | Source |
|---|---|
| 2',4'-difluoro-4-hydroxy-3-biphenylcarboxylic acid | NIST Chemistry WebBook |
| 2-(hydroxy)-5-(2,4-difluorophenyl)benzoic acid | ChemIDplus |
| 5-(2,4-difluorophenyl)salicylic acid | ChemIDplus |
| Diflunisal | KEGG COMPOUND |
| Dolobid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1FL | PDBeChem |
| 880 | DrugCentral |
| C01691 | KEGG COMPOUND |
| D00130 | KEGG DRUG |
| DB00861 | DrugBank |
| Diflunisal | Wikipedia |
| HMDB0014999 | HMDB |
| LSM-2490 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2654431 | Reaxys |
| CAS:22494-42-4 | NIST Chemistry WebBook |
| CAS:22494-42-4 | KEGG COMPOUND |
| CAS:22494-42-4 | ChemIDplus |
| Citations |
|---|