EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H36O6 |
| Net Charge | 0 |
| Average Mass | 408.535 |
| Monoisotopic Mass | 408.25119 |
| SMILES | [H][C@@]12C(=CCC[C@@H]1OC(=O)[C@@H](C)CC)C=C[C@H](C)[C@@H]2CC[C@@H](O)C[C@@H](O)CC(=O)O |
| InChI | InChI=1S/C23H36O6/c1-4-14(2)23(28)29-20-7-5-6-16-9-8-15(3)19(22(16)20)11-10-17(24)12-18(25)13-21(26)27/h6,8-9,14-15,17-20,22,24-25H,4-5,7,10-13H2,1-3H3,(H,26,27)/t14-,15-,17+,18+,19-,20-,22-/m0/s1 |
| InChIKey | BOZILQFLQYBIIY-INTXDZFKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor Any EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that inhibits HMG-CoA reductases. Hydroxymethylglutaryl-CoA reductase inhibitors have been shown to lower directly cholesterol synthesis. The Enzyme Commission designation is EC 1.1.1.34 for the NADPH-dependent enzyme and EC 1.1.1.88 for an NADH-dependent enzyme. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mevinic acid (CHEBI:39508) has role EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor (CHEBI:35664) |
| mevinic acid (CHEBI:39508) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| mevinic acid (CHEBI:39508) is a carboxylic ester (CHEBI:33308) |
| mevinic acid (CHEBI:39508) is a hexahydronaphthalenes (CHEBI:142348) |
| mevinic acid (CHEBI:39508) is a polyketide (CHEBI:26188) |
| mevinic acid (CHEBI:39508) is conjugate acid of mevinic acid anion (CHEBI:142050) |
| Incoming Relation(s) |
| mevinic acid anion (CHEBI:142050) is conjugate base of mevinic acid (CHEBI:39508) |
| IUPAC Name |
|---|
| (3R,5R)-3,5-dihydroxy-7-[(1S,2S,8S,8aR)-2-methyl-8-{[(2S)-2-methylbutanoyl]oxy}-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]heptanoic acid |
| Synonyms | Source |
|---|---|
| mevastatin (acid form) | ChemIDplus |
| ML 236B acid | ChemIDplus |
| mevastatin hydroxy acid | ChemIDplus |
| ML-236B acid | ChemIDplus |
| compactin acid | ChemIDplus |
| mevastatin acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:84064-38-0 | ChemIDplus |
| Citations |
|---|