EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H25NO4 |
| Net Charge | 0 |
| Average Mass | 331.412 |
| Monoisotopic Mass | 331.17836 |
| SMILES | CC(C)=CC1C(C(=O)OCN2C(=O)C3=C(CCCC3)C2=O)C1(C)C |
| InChI | InChI=1S/C19H25NO4/c1-11(2)9-14-15(19(14,3)4)18(23)24-10-20-16(21)12-7-5-6-8-13(12)17(20)22/h9,14-15H,5-8,10H2,1-4H3 |
| InChIKey | CXBMCYHAMVGWJQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | |
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetramethrin (CHEBI:39397) has functional parent chrysanthemic acid (CHEBI:3680) |
| tetramethrin (CHEBI:39397) has role pyrethroid ester insecticide (CHEBI:39116) |
| tetramethrin (CHEBI:39397) is a cyclopropanecarboxylate ester (CHEBI:50351) |
| tetramethrin (CHEBI:39397) is a maleimides (CHEBI:55417) |
| tetramethrin (CHEBI:39397) is a phthalimide insecticide (CHEBI:39398) |
| Incoming Relation(s) |
| (1R)-tetramethrin (CHEBI:39399) is a tetramethrin (CHEBI:39397) |
| IUPAC Name |
|---|
| (1,3-dioxo-1,3,4,5,6,7-hexahydro-2H-isoindol-2-yl)methyl 2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropanecarboxylate |
| Synonyms | Source |
|---|---|
| Neopinamin | ChemIDplus |
| Neo-pynamin | KEGG COMPOUND |
| Phthalthrin | KEGG COMPOUND |