EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:39347 - chlorfenapyr
| Formula | C15H11BrClF3N2O |
| Net Charge | 0 |
| Average Mass | 407.617 |
| Monoisotopic Mass | 405.96954 |
| SMILES | CCOCn1c(-c2ccc(Cl)cc2)c(C#N)c(Br)c1C(F)(F)F |
| InChI | InChI=1S/C15H11BrClF3N2O/c1-2-23-8-22-13(9-3-5-10(17)6-4-9)11(7-21)12(16)14(22)15(18,19)20/h3-6H,2,8H2,1H3 |
| InChIKey | CWFOCCVIPCEQCK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | proinsecticide A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active insecticide for which it is a proinsecticide. proacaricide A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active insecticide for which it is a proacaricide. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorfenapyr (CHEBI:39347) has functional parent tralopyril (CHEBI:141497) |
| chlorfenapyr (CHEBI:39347) has role proacaricide (CHEBI:136647) |
| chlorfenapyr (CHEBI:39347) has role proinsecticide (CHEBI:136644) |
| chlorfenapyr (CHEBI:39347) is a hemiaminal ether (CHEBI:141498) |
| chlorfenapyr (CHEBI:39347) is a monochlorobenzenes (CHEBI:83403) |
| chlorfenapyr (CHEBI:39347) is a nitrile (CHEBI:18379) |
| chlorfenapyr (CHEBI:39347) is a organochlorine acaricide (CHEBI:38657) |
| chlorfenapyr (CHEBI:39347) is a organochlorine insecticide (CHEBI:25705) |
| chlorfenapyr (CHEBI:39347) is a organofluorine acaricide (CHEBI:38806) |
| chlorfenapyr (CHEBI:39347) is a organofluorine insecticide (CHEBI:38804) |
| chlorfenapyr (CHEBI:39347) is a pyrroles (CHEBI:26455) |
| IUPAC Name |
|---|
| 4-bromo-2-(4-chlorophenyl)-1-(ethoxymethyl)-5-(trifluoromethyl)-1H-pyrrole-3-carbonitrile |
| Synonyms | Source |
|---|---|
| CL 303630 | ChemIDplus |
| Chlorfenapyr | ChemIDplus |
| Pirate | ChemIDplus |
| AC 303630 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C18455 | KEGG COMPOUND |
| chlorfenapyr | Alan Wood's Pesticides |
| 136 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6940152 | Beilstein |
| CAS:122453-73-0 | ChemIDplus |
| CAS:122453-73-0 | KEGG COMPOUND |
| Citations |
|---|