EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H5BrClF3N2 |
| Net Charge | 0 |
| Average Mass | 349.537 |
| Monoisotopic Mass | 347.92767 |
| SMILES | N#Cc1c(-c2ccc(Cl)cc2)nc(C(F)(F)F)c1Br |
| InChI | InChI=1S/C12H5BrClF3N2/c13-9-8(5-18)10(19-11(9)12(15,16)17)6-1-3-7(14)4-2-6/h1-4,19H |
| InChIKey | XNFIRYXKTXAHAC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antifouling biocide A compound that inhibits the growth of marine organisms. acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tralopyril (CHEBI:141497) has role acaricide (CHEBI:22153) |
| tralopyril (CHEBI:141497) has role antifouling biocide (CHEBI:51076) |
| tralopyril (CHEBI:141497) has role insecticide (CHEBI:24852) |
| tralopyril (CHEBI:141497) is a monochlorobenzenes (CHEBI:83403) |
| tralopyril (CHEBI:141497) is a nitrile (CHEBI:18379) |
| tralopyril (CHEBI:141497) is a organobromine compound (CHEBI:37141) |
| tralopyril (CHEBI:141497) is a organochlorine acaricide (CHEBI:38657) |
| tralopyril (CHEBI:141497) is a organochlorine insecticide (CHEBI:25705) |
| tralopyril (CHEBI:141497) is a organofluorine acaricide (CHEBI:38806) |
| tralopyril (CHEBI:141497) is a organofluorine insecticide (CHEBI:38804) |
| tralopyril (CHEBI:141497) is a pyrroles (CHEBI:26455) |
| Incoming Relation(s) |
| chlorfenapyr (CHEBI:39347) has functional parent tralopyril (CHEBI:141497) |
| IUPAC Name |
|---|
| 4-bromo-2-(4-chlorophenyl)-5-(trifluoromethyl)-1H-pyrrole-3-carbonitrile |
| Synonyms | Source |
|---|---|
| 2-p-chlorophenyl-4-bromo-5-trifluoromethyl-3-cyanopyrrole | ChEBI |
| 4-bromo-2-(4-chlorophenyl)-5-trifluoromethylpyrrole-3-carbonitrile | ChEBI |
| 4-bromo-2-(4-chlorophenyl)-5-(trifluoromethyl)pyrrole-3-carbonitrile | ChEBI |
| 4-bromo-2-(p-chlorophenyl)-5-(trifluoromethyl)-pyrrole-3-carbonitrile | ChEBI |
| 4-bromo-2-(p-chlorophenyl)-5-(trifluoromethyl)pyrrole-3-carbonitrile | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| tralopyril | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8395181 | Reaxys |
| CAS:122454-29-9 | ChemIDplus |
| Citations |
|---|