EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H19Cl2NO3 |
| Net Charge | 0 |
| Average Mass | 416.304 |
| Monoisotopic Mass | 415.07420 |
| SMILES | CC1(C)[C@H](C=C(Cl)Cl)[C@@H]1C(=O)O[C@@H](C#N)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C22H19Cl2NO3/c1-22(2)17(12-19(23)24)20(22)21(26)28-18(13-25)14-7-6-10-16(11-14)27-15-8-4-3-5-9-15/h3-12,17-18,20H,1-2H3/t17-,18+,20-/m1/s1 |
| InChIKey | KAATUXNTWXVJKI-WSTZPKSXSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S)-cis-(αR)-cypermethrin (CHEBI:39335) is a cyclopropanecarboxylate ester (CHEBI:50351) |
| (1S)-cis-(αR)-cypermethrin (CHEBI:39335) is enantiomer of (1R)-cis-(αS)-cypermethrin (CHEBI:39336) |
| Incoming Relation(s) |
| α-cypermethrin (CHEBI:39331) has part (1S)-cis-(αR)-cypermethrin (CHEBI:39335) |
| β-cypermethrin (CHEBI:39332) has part (1S)-cis-(αR)-cypermethrin (CHEBI:39335) |
| (1R)-cis-(αS)-cypermethrin (CHEBI:39336) is enantiomer of (1S)-cis-(αR)-cypermethrin (CHEBI:39335) |
| IUPAC Name |
|---|
| (R)-cyano(3-phenoxyphenyl)methyl (1S,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate |
| Synonym | Source |
|---|---|
| Alphamethrin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C18715 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8161284 | Beilstein |