EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11N5O |
| Net Charge | 0 |
| Average Mass | 217.232 |
| Monoisotopic Mass | 217.09636 |
| SMILES | CC1=NNC(=O)N(/N=C/c2cccnc2)C1 |
| InChI | InChI=1S/C10H11N5O/c1-8-7-15(10(16)14-13-8)12-6-9-3-2-4-11-5-9/h2-6H,7H2,1H3,(H,14,16)/b12-6+ |
| InChIKey | QHMTXANCGGJZRX-WUXMJOGZSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. TRPV channel modulator Any transient receptor potential (TRP) channel modulator that modulates the TRPV channels (V = vanilloid). There is strong evidence that action at one or more of this class of proteins is responsible for the insecticidal action of pymetrozine, pyrifluquinazon, and afidopyropen. |
| Application: | antifeedant A substance that prevents pests from feeding. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pymetrozine (CHEBI:39311) has role antifeedant (CHEBI:22583) |
| pymetrozine (CHEBI:39311) has role environmental contaminant (CHEBI:78298) |
| pymetrozine (CHEBI:39311) has role TRPV channel modulator (CHEBI:142782) |
| pymetrozine (CHEBI:39311) has role xenobiotic (CHEBI:35703) |
| pymetrozine (CHEBI:39311) is a 1,2,4-triazines (CHEBI:39410) |
| pymetrozine (CHEBI:39311) is a pyridines (CHEBI:26421) |
| IUPAC Name |
|---|
| 6-methyl-4-{[(1E)-pyridin-3-ylmethylene]amino}-4,5-dihydro-1,2,4-triazin-3(2H)-one |
| Synonyms | Source |
|---|---|
| (E)-4,5-dihydro-6-methyl-4-((3-pyridinylmethylene)amino)-1,2,4-triazin-3(2H)-one | ChemIDplus |
| Pymetrozine | ChemIDplus |
| pymétrozine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 562 | PPDB |
| C18590 | KEGG COMPOUND |
| pymetrozine | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7814151 | Reaxys |
| CAS:123312-89-0 | KEGG COMPOUND |
| CAS:123312-89-0 | ChemIDplus |
| Citations |
|---|