EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H18Cl2FNO3 |
| Net Charge | 0 |
| Average Mass | 434.294 |
| Monoisotopic Mass | 433.06478 |
| SMILES | CC1(C)[C@@H](C=C(Cl)Cl)[C@@H]1C(=O)O[C@@H](C#N)c1ccc(F)c(Oc2ccccc2)c1 |
| InChI | InChI=1S/C22H18Cl2FNO3/c1-22(2)15(11-19(23)24)20(22)21(27)29-18(12-26)13-8-9-16(25)17(10-13)28-14-6-4-3-5-7-14/h3-11,15,18,20H,1-2H3/t15-,18-,20+/m0/s1 |
| InChIKey | QQODLKZGRKWIFG-ZAAXVRCTSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S)-trans-(αR)-cyfluthrin (CHEBI:39310) is a cyclopropanecarboxylate ester (CHEBI:50351) |
| (1S)-trans-(αR)-cyfluthrin (CHEBI:39310) is enantiomer of (1R)-trans-(αS)-cyfluthrin (CHEBI:39312) |
| Incoming Relation(s) |
| β-cyfluthrin (CHEBI:39314) has part (1S)-trans-(αR)-cyfluthrin (CHEBI:39310) |
| (1R)-trans-(αS)-cyfluthrin (CHEBI:39312) is enantiomer of (1S)-trans-(αR)-cyfluthrin (CHEBI:39310) |
| Synonym | Source |
|---|---|
| (R)-cyano(4-fluoro-3-phenoxyphenyl)methyl (1S,3R)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8351888 | Beilstein |