EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H30N2O2 |
| Net Charge | 0 |
| Average Mass | 426.560 |
| Monoisotopic Mass | 426.23073 |
| SMILES | [H][C@@]1(C(C(N)=O)(c2ccccc2)c2ccccc2)CCN(CCc2ccc3c(c2)CCO3)C1 |
| InChI | InChI=1S/C28H30N2O2/c29-27(31)28(23-7-3-1-4-8-23,24-9-5-2-6-10-24)25-14-17-30(20-25)16-13-21-11-12-26-22(19-21)15-18-32-26/h1-12,19,25H,13-18,20H2,(H2,29,31)/t25-/m1/s1 |
| InChIKey | HXGBXQDTNZMWGS-RUZDIDTESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| darifenacin (CHEBI:391960) has role antispasmodic drug (CHEBI:53784) |
| darifenacin (CHEBI:391960) has role muscarinic antagonist (CHEBI:48876) |
| darifenacin (CHEBI:391960) is a 1-benzofurans (CHEBI:38830) |
| darifenacin (CHEBI:391960) is a monocarboxylic acid amide (CHEBI:29347) |
| darifenacin (CHEBI:391960) is a pyrrolidines (CHEBI:38260) |
| Incoming Relation(s) |
| darifenacin hydrobromide (CHEBI:31455) has part darifenacin (CHEBI:391960) |
| IUPAC Name |
|---|
| 2-{(3S)-1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]pyrrolidin-3-yl}-2,2-diphenylacetamide |
| INN | Source |
|---|---|
| darifenacin | ChemIDplus |
| Synonyms | Source |
|---|---|
| DARIFENACIN | ChEMBL |
| (S)-1-(2-(2,3-dihydro-5-benzofuranyl)ethyl)-α,α-diphenyl-3-pyrrolidineacetamide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 784 | DrugCentral |
| D03654 | KEGG DRUG |
| Darifenacin | Wikipedia |
| DB00496 | DrugBank |
| LSM-5995 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8449641 | Beilstein |
| CAS:133099-04-4 | ChemIDplus |
| Citations |
|---|