EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H30N2O2.HBr |
| Net Charge | 0 |
| Average Mass | 507.472 |
| Monoisotopic Mass | 506.15689 |
| SMILES | Br.[H][C@@]1(C(C(N)=O)(c2ccccc2)c2ccccc2)CCN(CCc2ccc3c(c2)CCO3)C1 |
| InChI | InChI=1S/C28H30N2O2.BrH/c29-27(31)28(23-7-3-1-4-8-23,24-9-5-2-6-10-24)25-14-17-30(20-25)16-13-21-11-12-26-22(19-21)15-18-32-26;/h1-12,19,25H,13-18,20H2,(H2,29,31);1H/t25-;/m1./s1 |
| InChIKey | UQAVIASOPREUIT-VQIWEWKSSA-N |
| Roles Classification |
|---|
| Biological Role: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Application: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| darifenacin hydrobromide (CHEBI:31455) has part darifenacin (CHEBI:391960) |
| darifenacin hydrobromide (CHEBI:31455) has role muscarinic antagonist (CHEBI:48876) |
| darifenacin hydrobromide (CHEBI:31455) is a hydrobromide (CHEBI:48367) |
| IUPAC Name |
|---|
| 2-{(3S)-1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]pyrrolidin-3-yl}-2,2-diphenylacetamide hydrobromide |
| Synonyms | Source |
|---|---|
| darifenacin HBr | ChEBI |
| Darifenacin hydrobromide | KEGG DRUG |
| (S)-2-{1-(2-(2,3-dihydrobenzofuran-5-yl)ethyl)-3-pyrrolidnyl}-2,2-diphenylacetamide hydrobromide | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:10225902 | Beilstein |
| CAS:133099-07-7 | KEGG DRUG |
| CAS:133099-07-7 | ChemIDplus |