EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10ClN5O3S |
| Net Charge | 0 |
| Average Mass | 291.720 |
| Monoisotopic Mass | 291.01929 |
| SMILES | CN1COCN(Cc2cnc(Cl)s2)/C1=N/[N+](=O)[O-] |
| InChI | InChI=1S/C8H10ClN5O3S/c1-12-4-17-5-13(8(12)11-14(15)16)3-6-2-10-7(9)18-6/h2H,3-5H2,1H3/b11-8+ |
| InChIKey | NWWZPOKUUAIXIW-DHZHZOJOSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | neonicotinoid insectide A class of neuro-active insecticides that act at the nicotinic acetylcholine receptor. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | antifeedant A substance that prevents pests from feeding. neonicotinoid insectide A class of neuro-active insecticides that act at the nicotinic acetylcholine receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-thiamethoxam (CHEBI:39186) is a thiamethoxam (CHEBI:39185) |
| IUPAC Name |
|---|
| (4E)-3-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-methyl-N-nitro-1,3,5-oxadiazinan-4-imine |
| Manual Xrefs | Databases |
|---|---|
| C18513 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8491021 | Beilstein |
| CAS:153719-23-4 | KEGG COMPOUND |