EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10ClN5O3S |
| Net Charge | 0 |
| Average Mass | 291.720 |
| Monoisotopic Mass | 291.01929 |
| SMILES | CN1COCN(Cc2cnc(Cl)s2)C1=N[N+](=O)[O-] |
| InChI | InChI=1S/C8H10ClN5O3S/c1-12-4-17-5-13(8(12)11-14(15)16)3-6-2-10-7(9)18-6/h2H,3-5H2,1H3 |
| InChIKey | NWWZPOKUUAIXIW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | neonicotinoid insectide A class of neuro-active insecticides that act at the nicotinic acetylcholine receptor. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Applications: | neonicotinoid insectide A class of neuro-active insecticides that act at the nicotinic acetylcholine receptor. antifeedant A substance that prevents pests from feeding. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiamethoxam (CHEBI:39185) has functional parent 2-chlorothiazole (CHEBI:39187) |
| thiamethoxam (CHEBI:39185) has role antifeedant (CHEBI:22583) |
| thiamethoxam (CHEBI:39185) has role carcinogenic agent (CHEBI:50903) |
| thiamethoxam (CHEBI:39185) has role environmental contaminant (CHEBI:78298) |
| thiamethoxam (CHEBI:39185) has role neonicotinoid insectide (CHEBI:25540) |
| thiamethoxam (CHEBI:39185) has role xenobiotic (CHEBI:35703) |
| thiamethoxam (CHEBI:39185) is a 1,3-thiazoles (CHEBI:38418) |
| thiamethoxam (CHEBI:39185) is a 2-nitroguanidine derivative (CHEBI:84773) |
| thiamethoxam (CHEBI:39185) is a organochlorine compound (CHEBI:36683) |
| thiamethoxam (CHEBI:39185) is a oxadiazane (CHEBI:48898) |
| Incoming Relation(s) |
| (E)-thiamethoxam (CHEBI:39186) is a thiamethoxam (CHEBI:39185) |
| IUPAC Name |
|---|
| 3-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-methyl-N-nitro-1,3,5-oxadiazinan-4-imine |
| Synonyms | Source |
|---|---|
| 3-((2-chloro-5-thiazolyl)methyl)tetrahydro-5-methyl-N-nitro-4H-1,3,5-oxadiazin-4-imine | ChemIDplus |
| Thiamethoxam | ChemIDplus |
| TMX | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 631 | PPDB |
| C18513 | KEGG COMPOUND |
| thiamethoxam | Alan Wood's Pesticides |
| Thiamethoxam | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8555232 | Reaxys |
| CAS:153719-23-4 | ChemIDplus |
| Citations |
|---|