EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:39178 - clothianidin
| Formula | C6H8ClN5O2S |
| Net Charge | 0 |
| Average Mass | 249.683 |
| Monoisotopic Mass | 249.00872 |
| SMILES | CNC(=N[N+](=O)[O-])NCc1cnc(Cl)s1 |
| InChI | InChI=1S/C6H8ClN5O2S/c1-8-6(11-12(13)14)10-3-4-2-9-5(7)15-4/h2H,3H2,1H3,(H2,8,10,11) |
| InChIKey | PGOOBECODWQEAB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. neonicotinoid insectide A class of neuro-active insecticides that act at the nicotinic acetylcholine receptor. nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. |
| Applications: | neonicotinoid insectide A class of neuro-active insecticides that act at the nicotinic acetylcholine receptor. nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clothianidin (CHEBI:39178) has functional parent 2-chlorothiazole (CHEBI:39187) |
| clothianidin (CHEBI:39178) has functional parent 2-nitroguanidine (CHEBI:39181) |
| clothianidin (CHEBI:39178) has role environmental contaminant (CHEBI:78298) |
| clothianidin (CHEBI:39178) has role neonicotinoid insectide (CHEBI:25540) |
| clothianidin (CHEBI:39178) has role nicotinic acetylcholine receptor agonist (CHEBI:47958) |
| clothianidin (CHEBI:39178) has role xenobiotic (CHEBI:35703) |
| clothianidin (CHEBI:39178) is a 1,3-thiazoles (CHEBI:38418) |
| clothianidin (CHEBI:39178) is a 2-nitroguanidine derivative (CHEBI:84773) |
| clothianidin (CHEBI:39178) is a organochlorine compound (CHEBI:36683) |
| Incoming Relation(s) |
| (E)-clothianidin (CHEBI:39177) is a clothianidin (CHEBI:39178) |
| IUPAC Name |
|---|
| 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-methyl-2-nitroguanidine |
| Synonym | Source |
|---|---|
| CLO | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C18508 | KEGG COMPOUND |
| CT4 | PDBeChem |
| Clothianidin | Wikipedia |
| clothianidin | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9196326 | Reaxys |
| Citations |
|---|