EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8ClN5O2S |
| Net Charge | 0 |
| Average Mass | 249.683 |
| Monoisotopic Mass | 249.00872 |
| SMILES | CN/C(=N\[N+](=O)[O-])NCc1cnc(Cl)s1 |
| InChI | InChI=1S/C6H8ClN5O2S/c1-8-6(11-12(13)14)10-3-4-2-9-5(7)15-4/h2H,3H2,1H3,(H2,8,10,11) |
| InChIKey | PGOOBECODWQEAB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | neonicotinoid insectide A class of neuro-active insecticides that act at the nicotinic acetylcholine receptor. nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. neonicotinoid insectide A class of neuro-active insecticides that act at the nicotinic acetylcholine receptor. |
| Applications: | neonicotinoid insectide A class of neuro-active insecticides that act at the nicotinic acetylcholine receptor. nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. neonicotinoid insectide A class of neuro-active insecticides that act at the nicotinic acetylcholine receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-clothianidin (CHEBI:39177) has role neonicotinoid insectide (CHEBI:25540) |
| (E)-clothianidin (CHEBI:39177) is a clothianidin (CHEBI:39178) |
| IUPAC Name |
|---|
| (E)-1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-methyl-2-nitroguanidine |
| Synonyms | Source |
|---|---|
| Clothianidin | ChemIDplus |
| (E)-N-(2-chloro-5-thiazolyl)methyl-N'-methyl-N''-nitroguanidine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8620724 | Beilstein |
| CAS:205510-53-8 | ChemIDplus |
| CAS:210880-92-5 | ChemIDplus |
| CAS:210880-92-5 | KEGG COMPOUND |