EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H15ClN4O2 |
| Net Charge | 0 |
| Average Mass | 270.720 |
| Monoisotopic Mass | 270.08835 |
| SMILES | [H]C(=C(NC)N(CC)Cc1ccc(Cl)nc1)[N+](=O)[O-] |
| InChI | InChI=1S/C11H15ClN4O2/c1-3-15(11(13-2)8-16(17)18)7-9-4-5-10(12)14-6-9/h4-6,8,13H,3,7H2,1-2H3 |
| InChIKey | CFRPSFYHXJZSBI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | neonicotinoid insectide A class of neuro-active insecticides that act at the nicotinic acetylcholine receptor. |
| Application: | neonicotinoid insectide A class of neuro-active insecticides that act at the nicotinic acetylcholine receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nitenpyram (CHEBI:39171) has functional parent 2-chloropyridine (CHEBI:39174) |
| nitenpyram (CHEBI:39171) has role neonicotinoid insectide (CHEBI:25540) |
| nitenpyram (CHEBI:39171) is a C-nitro compound (CHEBI:35716) |
| nitenpyram (CHEBI:39171) is a monochloropyridine (CHEBI:39172) |
| Incoming Relation(s) |
| (E)-nitenpyram (CHEBI:39170) is a nitenpyram (CHEBI:39171) |
| IUPAC Name |
|---|
| N-[(6-chloropyridin-3-yl)methyl]-N-ethyl-N'-methyl-2-nitroethene-1,1-diamine |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8553513 | Reaxys |
| Citations |
|---|