EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H15ClN4O2 |
| Net Charge | 0 |
| Average Mass | 270.720 |
| Monoisotopic Mass | 270.08835 |
| SMILES | CCN(Cc1ccc(Cl)nc1)/C(=C/[N+](=O)[O-])NC |
| InChI | InChI=1S/C11H15ClN4O2/c1-3-15(11(13-2)8-16(17)18)7-9-4-5-10(12)14-6-9/h4-6,8,13H,3,7H2,1-2H3/b11-8+ |
| InChIKey | CFRPSFYHXJZSBI-DHZHZOJOSA-N |
| Roles Classification |
|---|
| Biological Role: | neonicotinoid insectide A class of neuro-active insecticides that act at the nicotinic acetylcholine receptor. |
| Applications: | neonicotinoid insectide A class of neuro-active insecticides that act at the nicotinic acetylcholine receptor. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-nitenpyram (CHEBI:39170) is a chloropyridyl insecticide (CHEBI:39167) |
| (E)-nitenpyram (CHEBI:39170) is a nitenpyram (CHEBI:39171) |
| IUPAC Name |
|---|
| (E)-N-[(6-chloropyridin-3-yl)methyl]-N-ethyl-N'-methyl-2-nitroethene-1,1-diamine |
| Synonyms | Source |
|---|---|
| nitenpyram | ChemIDplus |
| (E)-nitenpyram | ChemIDplus |
| (1E)-N-((6-chloro-3-pyridinyl)methyl)-N-ethyl-N'-methyl-2-nitro-1,1-ethenediamine | ChemIDplus |
| TI 304 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8489488 | Beilstein |
| CAS:150824-47-8 | ChemIDplus |
| CAS:150824-47-8 | KEGG COMPOUND |