EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O2 |
| Net Charge | 0 |
| Average Mass | 232.323 |
| Monoisotopic Mass | 232.14633 |
| SMILES | C=C1C(=O)O[C@@H]2/C=C(\C)CC/C=C(\C)CC[C@@H]12 |
| InChI | InChI=1S/C15H20O2/c1-10-5-4-6-11(2)9-14-13(8-7-10)12(3)15(16)17-14/h5,9,13-14H,3-4,6-8H2,1-2H3/b10-5+,11-9+/t13-,14+/m0/s1 |
| InChIKey | HRYLQFBHBWLLLL-AHNJNIBGSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saussurea lappa (ncbitaxon:324593) | root (BTO:0001188) | PubMed (18409040) | |
| Laurus nobilis (ncbitaxon:85223) | - | PubMed (11912066) | |
| Magnolia sieboldii (ncbitaxon:85868) | - | PubMed (11534769) |
| Roles Classification |
|---|
| Biological Roles: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | anthelminthic drug Substance intended to kill parasitic worms (helminths). antiviral drug A substance used in the prophylaxis or therapy of virus diseases. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antiparasitic agent A substance used to treat or prevent parasitic infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| costunolide (CHEBI:3900) has role anthelminthic drug (CHEBI:35443) |
| costunolide (CHEBI:3900) has role antiinfective agent (CHEBI:35441) |
| costunolide (CHEBI:3900) has role antineoplastic agent (CHEBI:35610) |
| costunolide (CHEBI:3900) has role antiparasitic agent (CHEBI:35442) |
| costunolide (CHEBI:3900) has role antiviral drug (CHEBI:36044) |
| costunolide (CHEBI:3900) has role metabolite (CHEBI:25212) |
| costunolide (CHEBI:3900) is a germacranolide (CHEBI:73011) |
| costunolide (CHEBI:3900) is a heterobicyclic compound (CHEBI:33672) |
| Incoming Relation(s) |
| 3β-hydroxycostunolide (CHEBI:144560) has functional parent costunolide (CHEBI:3900) |
| 6α-hydroxygermacra-1(10),4,11(13)-trien-12-oate (CHEBI:141318) has functional parent costunolide (CHEBI:3900) |
| IUPAC Name |
|---|
| (3aS,6E,10E,11aR)-6,10-dimethyl-3-methylene-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2(3H)-one |
| Synonyms | Source |
|---|---|
| Costunolide | KEGG COMPOUND |
| (E,E)-6-alpha-Hydroxygermacra-1(10),4,11(13)-trien-12-oic acid gamma-lactone | ChemIDplus |
| Costunlide | ChemIDplus |
| Costunolid | ChemIDplus |
| Costus lactone | ChemIDplus |
| (E,E)-germacra-1(10),4,11(13)-trien-12-oic acid, 6-alpha-hydroxy-gamma-lactone | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (+)-costunolide | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C09382 | KEGG COMPOUND |
| KR20000066932 | Patent |
| Costunolide | Wikipedia |
| C00003240 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14451 | Reaxys |
| CAS:553-21-9 | KEGG COMPOUND |
| CAS:553-21-9 | ChemIDplus |
| Citations |
|---|