EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O2 |
| Net Charge | 0 |
| Average Mass | 232.323 |
| Monoisotopic Mass | 232.14633 |
| SMILES | C=C1C(=O)O[C@@H]2/C=C(\C)CC/C=C(\C)CC[C@@H]12 |
| InChI | InChI=1S/C15H20O2/c1-10-5-4-6-11(2)9-14-13(8-7-10)12(3)15(16)17-14/h5,9,13-14H,3-4,6-8H2,1-2H3/b10-5+,11-9+/t13-,14+/m0/s1 |
| InChIKey | HRYLQFBHBWLLLL-AHNJNIBGSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Laurus nobilis (ncbitaxon:85223) | - | PubMed (11912066) | |
| Magnolia sieboldii (ncbitaxon:85868) | - | PubMed (11534769) | |
| Saussurea lappa (ncbitaxon:324593) | root (BTO:0001188) | PubMed (18409040) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anthelminthic drug Substance intended to kill parasitic worms (helminths). antiparasitic agent A substance used to treat or prevent parasitic infections. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| costunolide (CHEBI:3900) has role anthelminthic drug (CHEBI:35443) |
| costunolide (CHEBI:3900) has role antiinfective agent (CHEBI:35441) |
| costunolide (CHEBI:3900) has role antineoplastic agent (CHEBI:35610) |
| costunolide (CHEBI:3900) has role antiparasitic agent (CHEBI:35442) |
| costunolide (CHEBI:3900) has role antiviral drug (CHEBI:36044) |
| costunolide (CHEBI:3900) has role metabolite (CHEBI:25212) |
| costunolide (CHEBI:3900) is a germacranolide (CHEBI:73011) |
| costunolide (CHEBI:3900) is a heterobicyclic compound (CHEBI:33672) |
| Incoming Relation(s) |
| 3β-hydroxycostunolide (CHEBI:144560) has functional parent costunolide (CHEBI:3900) |
| 6α-hydroxygermacra-1(10),4,11(13)-trien-12-oate (CHEBI:141318) has functional parent costunolide (CHEBI:3900) |
| IUPAC Name |
|---|
| (3aS,6E,10E,11aR)-6,10-dimethyl-3-methylene-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2(3H)-one |
| Synonyms | Source |
|---|---|
| (10S,1R)-3,7-dimethyl-11-methylene-13-oxabicyclo[8.3.0]trideca-2,6-dien-12-one | ChEBI |
| (3aS,6E,10E,11aR)-6,10-dimethyl-3-methylidene-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2(3H)-one | ChEBI |
| (3aS,6E,10E)-3-methylene-6,10-dimethyl-2,3,3aβ,4,5,8,9,11aα-octahydrocyclodeca[b]furan-2-one | ChEBI |
| Costunlide | ChemIDplus |
| Costunolid | ChemIDplus |
| (+)-costunolide | ChEBI |
| UniProt Name | Source |
|---|---|
| (+)-costunolide | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00003240 | KNApSAcK |
| C09382 | KEGG COMPOUND |
| Costunolide | Wikipedia |
| KR20000066932 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14451 | Reaxys |
| CAS:553-21-9 | ChemIDplus |
| CAS:553-21-9 | KEGG COMPOUND |
| Citations |
|---|