EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O3 |
| Net Charge | 0 |
| Average Mass | 248.322 |
| Monoisotopic Mass | 248.14124 |
| SMILES | C=C1C(=O)O[C@@H]2/C=C(\C)[C@@H](O)C/C=C(\C)CC[C@@H]12 |
| InChI | InChI=1S/C15H20O3/c1-9-4-6-12-11(3)15(17)18-14(12)8-10(2)13(16)7-5-9/h5,8,12-14,16H,3-4,6-7H2,1-2H3/b9-5+,10-8+/t12-,13-,14+/m0/s1 |
| InChIKey | XQVSREKNQZKAKU-RZPRNJIHSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3β-hydroxycostunolide (CHEBI:144560) has functional parent costunolide (CHEBI:3900) |
| 3β-hydroxycostunolide (CHEBI:144560) has role plant metabolite (CHEBI:76924) |
| 3β-hydroxycostunolide (CHEBI:144560) is a germacranolide (CHEBI:73011) |
| 3β-hydroxycostunolide (CHEBI:144560) is a heterobicyclic compound (CHEBI:33672) |
| 3β-hydroxycostunolide (CHEBI:144560) is a secondary allylic alcohol (CHEBI:134396) |
| IUPAC Name |
|---|
| (3aS,6E,9S,10E,11aR)-9-hydroxy-6,10-dimethyl-3-methylene-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2(3H)-one |
| Synonyms | Source |
|---|---|
| chanfillin | KNApSAcK |
| hanfillin | KNApSAcK |
| hanphilline | KNApSAcK |
| hanphyllin | KNApSAcK |
| UniProt Name | Source |
|---|---|
| 3β-hydroxycostunolide | UniProt |
| Citations |
|---|