EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:38940 - sunitinib
| Formula | C22H27FN4O2 |
| Net Charge | 0 |
| Average Mass | 398.482 |
| Monoisotopic Mass | 398.21180 |
| SMILES | CCN(CC)CCNC(=O)c1c(C)nc(/C=C2\C(=O)Nc3ccc(F)cc32)c1C |
| InChI | InChI=1S/C22H27FN4O2/c1-5-27(6-2)10-9-24-22(29)20-13(3)19(25-14(20)4)12-17-16-11-15(23)7-8-18(16)26-21(17)28/h7-8,11-12,25H,5-6,9-10H2,1-4H3,(H,24,29)(H,26,28)/b17-12- |
| InChIKey | WINHZLLDWRZWRT-ATVHPVEESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. vascular endothelial growth factor receptor antagonist An antagonist at the vascular endothelial growth factor receptor. |
| Applications: | angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sunitinib (CHEBI:38940) has functional parent 3-methyleneoxindole (CHEBI:17920) |
| sunitinib (CHEBI:38940) has role angiogenesis inhibitor (CHEBI:48422) |
| sunitinib (CHEBI:38940) has role antineoplastic agent (CHEBI:35610) |
| sunitinib (CHEBI:38940) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| sunitinib (CHEBI:38940) has role immunomodulator (CHEBI:50846) |
| sunitinib (CHEBI:38940) has role neuroprotective agent (CHEBI:63726) |
| sunitinib (CHEBI:38940) has role vascular endothelial growth factor receptor antagonist (CHEBI:65207) |
| sunitinib (CHEBI:38940) is a monocarboxylic acid amide (CHEBI:29347) |
| sunitinib (CHEBI:38940) is a pyrroles (CHEBI:26455) |
| Incoming Relation(s) |
| linkable sunitinib analogue (CHEBI:39081) has functional parent sunitinib (CHEBI:38940) |
| sunitinib malate (CHEBI:232546) has part sunitinib (CHEBI:38940) |
| IUPAC Name |
|---|
| N-[2-(diethylamino)ethyl]-5-[(Z)-(5-fluoro-2-oxo-1,2-dihydro-3H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide |
| INNs | Source |
|---|---|
| sunitinib | ChEBI |
| sunitinibum | ChEBI |
| Synonyms | Source |
|---|---|
| Sutent | ChemIDplus |
| Sunitinib | ChemIDplus |
| SU-11248 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| DB01268 | DrugBank |
| Sunitinib | Wikipedia |
| HMDB0015397 | HMDB |
| 2544 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:557795-19-4 | ChemIDplus |
| Citations |
|---|