EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:38940 - sunitinib
| Formula | C22H27FN4O2 |
| Net Charge | 0 |
| Average Mass | 398.482 |
| Monoisotopic Mass | 398.21180 |
| SMILES | CCN(CC)CCNC(=O)c1c(C)nc(/C=C2\C(=O)Nc3ccc(F)cc32)c1C |
| InChI | InChI=1S/C22H27FN4O2/c1-5-27(6-2)10-9-24-22(29)20-13(3)19(25-14(20)4)12-17-16-11-15(23)7-8-18(16)26-21(17)28/h7-8,11-12,25H,5-6,9-10H2,1-4H3,(H,24,29)(H,26,28)/b17-12- |
| InChIKey | WINHZLLDWRZWRT-ATVHPVEESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. vascular endothelial growth factor receptor antagonist An antagonist at the vascular endothelial growth factor receptor. EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sunitinib (CHEBI:38940) has functional parent 3-methyleneoxindole (CHEBI:17920) |
| sunitinib (CHEBI:38940) has role angiogenesis inhibitor (CHEBI:48422) |
| sunitinib (CHEBI:38940) has role antineoplastic agent (CHEBI:35610) |
| sunitinib (CHEBI:38940) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| sunitinib (CHEBI:38940) has role immunomodulator (CHEBI:50846) |
| sunitinib (CHEBI:38940) has role neuroprotective agent (CHEBI:63726) |
| sunitinib (CHEBI:38940) has role vascular endothelial growth factor receptor antagonist (CHEBI:65207) |
| sunitinib (CHEBI:38940) is a monocarboxylic acid amide (CHEBI:29347) |
| sunitinib (CHEBI:38940) is a pyrroles (CHEBI:26455) |
| Incoming Relation(s) |
| linkable sunitinib analogue (CHEBI:39081) has functional parent sunitinib (CHEBI:38940) |
| sunitinib malate (CHEBI:232546) has part sunitinib (CHEBI:38940) |
| IUPAC Name |
|---|
| N-[2-(diethylamino)ethyl]-5-[(Z)-(5-fluoro-2-oxo-1,2-dihydro-3H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide |
| INNs | Source |
|---|---|
| sunitinib | ChEBI |
| sunitinibum | ChEBI |
| Synonyms | Source |
|---|---|
| SU-11248 | ChEBI |
| Sunitinib | ChemIDplus |
| Sutent | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2544 | DrugCentral |
| DB01268 | DrugBank |
| HMDB0015397 | HMDB |
| Sunitinib | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:557795-19-4 | ChemIDplus |
| Citations |
|---|