EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H27FN4O2.C4H6O5 |
| Net Charge | 0 |
| Average Mass | 532.569 |
| Monoisotopic Mass | 532.23333 |
| SMILES | [H]/C(=C1/C(O)=Nc2ccc(F)cc21)c1nc(C)c(/C(O)=N/CCN(CC)CC)c1C.[H][C@](O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H27FN4O2.C4H6O5/c1-5-27(6-2)10-9-24-22(29)20-13(3)19(25-14(20)4)12-17-16-11-15(23)7-8-18(16)26-21(17)28;5-2(4(8)9)1-3(6)7/h7-8,11-12,25H,5-6,9-10H2,1-4H3,(H,24,29)(H,26,28);2,5H,1H2,(H,6,7)(H,8,9)/b17-12-;/t;2-/m.0/s1 |
| InChIKey | LBWFXVZLPYTWQI-IPOVEDGCSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sunitinib malate (CHEBI:232546) has part sunitinib (CHEBI:38940) |
| sunitinib malate (CHEBI:232546) has role antineoplastic agent (CHEBI:35610) |
| sunitinib malate (CHEBI:232546) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| sunitinib malate (CHEBI:232546) is a organic molecular entity (CHEBI:50860) |
| Manual Xrefs | Databases |
|---|---|
| D06402 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:341031-54-7 | SUBMITTER |