EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:38622 - 4-cyanophenol
| Formula | C7H5NO |
| Net Charge | 0 |
| Average Mass | 119.123 |
| Monoisotopic Mass | 119.03711 |
| SMILES | N#Cc1ccc(O)cc1 |
| InChI | InChI=1S/C7H5NO/c8-5-6-1-3-7(9)4-2-6/h1-4,9H |
| InChIKey | CVNOWLNNPYYEOH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 1.4.3.4 (monoamine oxidase) inhibitor An EC 1.4.3.* (oxidoreductase acting on donor CH-NH2 group, oxygen as acceptor) inhibitor that interferes with the action of monoamine oxidase (EC 1.4.3.4). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-cyanophenol (CHEBI:38622) has functional parent benzonitrile (CHEBI:27991) |
| 4-cyanophenol (CHEBI:38622) has role EC 1.4.3.4 (monoamine oxidase) inhibitor (CHEBI:38623) |
| 4-cyanophenol (CHEBI:38622) is a phenols (CHEBI:33853) |
| Incoming Relation(s) |
| cyanophos (CHEBI:38621) has functional parent 4-cyanophenol (CHEBI:38622) |
| IUPAC Name |
|---|
| 4-hydroxybenzonitrile |
| Synonyms | Source |
|---|---|
| 4-Hydroxybenzoic acid nitrile | NIST Chemistry WebBook |
| p-Cyanophenol | ChemIDplus |
| p-Hydroxybenzonitrile | ChemIDplus |