EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:38621 - cyanophos
| Formula | C9H10NO3PS |
| Net Charge | 0 |
| Average Mass | 243.224 |
| Monoisotopic Mass | 243.01190 |
| SMILES | COP(=S)(OC)Oc1ccc(C#N)cc1 |
| InChI | InChI=1S/C9H10NO3PS/c1-11-14(15,12-2)13-9-5-3-8(7-10)4-6-9/h3-6H,1-2H3 |
| InChIKey | SCKHCCSZFPSHGR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyanophos (CHEBI:38621) has functional parent 4-cyanophenol (CHEBI:38622) |
| cyanophos (CHEBI:38621) has role agrochemical (CHEBI:33286) |
| cyanophos (CHEBI:38621) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| cyanophos (CHEBI:38621) is a organic thiophosphate (CHEBI:37512) |
| cyanophos (CHEBI:38621) is a organothiophosphate insecticide (CHEBI:25715) |
| IUPAC Name |
|---|
| O-(4-cyanophenyl) O,O-dimethyl phosphorothioate |
| Synonyms | Source |
|---|---|
| O-(4-cyanophenyl) O,O-dimethyl thiophosphate | IUPAC |
| Ciafos | ChemIDplus |
| 4-(Dimethoxyphosphinothioyloxy)benzonitrile | ChemIDplus |
| O,O-Dimethyl O-(4-cyanophenyl) thionophosphate | ChemIDplus |
| O,O-Dimethyl-O-p-cyanophenyl phosphorothioate | ChemIDplus |
| O-p-Cyanophenyl O,O-dimethyl phosphorothioate | ChemIDplus |