EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26N2 |
| Net Charge | 0 |
| Average Mass | 282.431 |
| Monoisotopic Mass | 282.20960 |
| SMILES | [H][C@@]12N3CCC[C@]1(CC)CC[C@@]1([H])Nc4ccccc4[C@@]21CC3 |
| InChI | InChI=1S/C19H26N2/c1-2-18-9-5-12-21-13-11-19(17(18)21)14-6-3-4-7-15(14)20-16(19)8-10-18/h3-4,6-7,16-17,20H,2,5,8-13H2,1H3/t16-,17-,18-,19-/m1/s1 |
| InChIKey | YAAIPCQYJYPITK-NCXUSEDFSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aspidospermidine (CHEBI:38486) is a Aspidosperma alkaloid (CHEBI:142772) |
| aspidospermidine (CHEBI:38486) is a indole alkaloid fundamental parent (CHEBI:38482) |
| Incoming Relation(s) |
| aspidospermine (CHEBI:28463) has parent hydride aspidospermidine (CHEBI:38486) |
| IUPAC Name |
|---|
| aspidospermidine |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1587608 | Beilstein |
| Citations |
|---|