EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30N2O2 |
| Net Charge | 0 |
| Average Mass | 354.494 |
| Monoisotopic Mass | 354.23073 |
| SMILES | [H][C@@]12N3CCC[C@]1(CC)CC[C@@]1([H])N(C(C)=O)c4c(OC)cccc4[C@@]21CC3 |
| InChI | InChI=1S/C22H30N2O2/c1-4-21-10-6-13-23-14-12-22(20(21)23)16-7-5-8-17(26-3)19(16)24(15(2)25)18(22)9-11-21/h5,7-8,18,20H,4,6,9-14H2,1-3H3/t18-,20-,21-,22-/m1/s1 |
| InChIKey | ARQOGCYMPUOVHK-ZHHKINOHSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aspidospermine (CHEBI:28463) has parent hydride aspidospermidine (CHEBI:38486) |
| aspidospermine (CHEBI:28463) is a indole alkaloid (CHEBI:38958) |
| IUPAC Name |
|---|
| 1-(17-methoxyaspidospermidin-1-yl)ethanone |
| Synonyms | Source |
|---|---|
| 1-Acetyl-17-methoxyaspidospermidine | ChemIDplus |
| (-)-Aspidospermine | ChemIDplus |
| Aspidospermine | KEGG COMPOUND |
| Citations |
|---|