EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H2Cl4O4 |
| Net Charge | 0 |
| Average Mass | 279.890 |
| Monoisotopic Mass | 277.87072 |
| SMILES | O=C(O)C(Cl)=C(Cl)C(Cl)=C(Cl)C(=O)O |
| InChI | InChI=1S/C6H2Cl4O4/c7-1(3(9)5(11)12)2(8)4(10)6(13)14/h(H,11,12)(H,13,14) |
| InChIKey | OPEJMVTXTHBTBS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetrachloromuconic acid (CHEBI:38437) is a chloromuconic acid (CHEBI:38408) |
| tetrachloromuconic acid (CHEBI:38437) is conjugate acid of tetrachloromuconate(2−) (CHEBI:38442) |
| Incoming Relation(s) |
| tetrachloro-cis,cis-muconic acid (CHEBI:26887) is a tetrachloromuconic acid (CHEBI:38437) |
| tetrachloro-trans,trans-muconic acid (CHEBI:38447) is a tetrachloromuconic acid (CHEBI:38437) |
| tetrachloromuconate(2−) (CHEBI:38442) is conjugate base of tetrachloromuconic acid (CHEBI:38437) |
| IUPAC Name |
|---|
| 2,3,4,5-tetrachlorohexa-2,4-dienedioic acid |
| Synonym | Source |
|---|---|
| 2,3,4,5-tetrachloro-2,4-hexadienedioic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1798114 | Beilstein |