EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H2Cl4O4 |
| Net Charge | 0 |
| Average Mass | 279.890 |
| Monoisotopic Mass | 277.87072 |
| SMILES | O=C(O)/C(Cl)=C(Cl)\C(Cl)=C(\Cl)C(=O)O |
| InChI | InChI=1S/C6H2Cl4O4/c7-1(3(9)5(11)12)2(8)4(10)6(13)14/h(H,11,12)(H,13,14)/b3-1-,4-2- |
| InChIKey | OPEJMVTXTHBTBS-CCAGOZQPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetrachloro-cis,cis-muconic acid (CHEBI:26887) has functional parent cis,cis-muconic acid (CHEBI:16508) |
| tetrachloro-cis,cis-muconic acid (CHEBI:26887) is a tetrachloromuconic acid (CHEBI:38437) |
| tetrachloro-cis,cis-muconic acid (CHEBI:26887) is conjugate acid of tetrachloro-cis,cis-muconate(2−) (CHEBI:38441) |
| Incoming Relation(s) |
| tetrachloro-cis,cis-muconate(2−) (CHEBI:38441) is conjugate base of tetrachloro-cis,cis-muconic acid (CHEBI:26887) |
| IUPAC Name |
|---|
| (2Z,4Z)-2,3,4,5-tetrachlorohexa-2,4-dienedioic acid |
| Synonym | Source |
|---|---|
| (Z,Z)-2,3,4,5-tetrachloro-2,4-hexadienedioic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C18241 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1713760 | Beilstein |