EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8O2 |
| Net Charge | 0 |
| Average Mass | 100.117 |
| Monoisotopic Mass | 100.05243 |
| SMILES | C/C=C\CC(=O)O |
| InChI | InChI=1S/C5H8O2/c1-2-3-4-5(6)7/h2-3H,4H2,1H3,(H,6,7)/b3-2- |
| InChIKey | UIUWNILCHFBLEQ-IHWYPQMZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-pent-3-enoic acid (CHEBI:38369) is a pent-3-enoic acid (CHEBI:38368) |
| IUPAC Name |
|---|
| (3Z)-pent-3-enoic acid |
| Synonyms | Source |
|---|---|
| C5:1, n-2 cis | ChEBI |
| cis-3-pentenoic acid | ChEBI |
| cis-Pent-3-ensäure | ChEBI |
| cis-β,γ-penteneoic acid | NIST Chemistry WebBook |
| (Z)-3-pentenoic acid | ChEBI |
| Z-3-Pentensäure | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1720745 | Reaxys |
| CAS:33698-87-2 | NIST Chemistry WebBook |
| CAS:33698-87-2 | ChemIDplus |