EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8O2 |
| Net Charge | 0 |
| Average Mass | 100.117 |
| Monoisotopic Mass | 100.05243 |
| SMILES | [H]C(=CC)CC(=O)O |
| InChI | InChI=1S/C5H8O2/c1-2-3-4-5(6)7/h2-3H,4H2,1H3,(H,6,7) |
| InChIKey | UIUWNILCHFBLEQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pent-3-enoic acid (CHEBI:38368) is a pentenoic acid (CHEBI:25897) |
| pent-3-enoic acid (CHEBI:38368) is conjugate acid of pent-3-enoate (CHEBI:231931) |
| Incoming Relation(s) |
| cis-pent-3-enoic acid (CHEBI:38369) is a pent-3-enoic acid (CHEBI:38368) |
| trans-pent-3-enoic acid (CHEBI:38370) is a pent-3-enoic acid (CHEBI:38368) |
| pent-3-enoate (CHEBI:231931) is conjugate base of pent-3-enoic acid (CHEBI:38368) |
| IUPAC Name |
|---|
| pent-3-enoic acid |
| Synonyms | Source |
|---|---|
| 1-propenylacetate | ChEBI |
| 3-pentenoic acid | NIST Chemistry WebBook |
| C5:1, n-2 | ChEBI |
| Pent-3-ensäure | ChEBI |
| β-Aethyliden-propionsäure | ChEBI |
| β-Butylen-α-carbonsäure | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01030006 | LIPID MAPS |
| TW581757B | Patent |